C12H12N2O3 — CID 54959294
3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzaldehyde (PubChem CID 54959294) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzaldehyde.
| Compound Name | 3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 54959294 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzaldehyde |
| SMILES | CCc1nc(COc2cccc(C=O)c2)no1 |
| InChI | InChI=1S/C12H12N2O3/c1-2-12-13-11(14-17-12)8-16-10-5-3-4-9(6-10)7-15/h3-7H,2,8H2,1H3 |
| InChIKey | IZGYUHUNTCAZGX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|