C11H10Cl2N2O2 — CID 52734301
3-[(3,5-dichlorophenoxy)methyl]-5-ethyl-1,2,4-oxadiazole (PubChem CID 52734301) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenoxy)methyl]-5-ethyl-1,2,4-oxadiazole.
| Compound Name | 3-[(3,5-dichlorophenoxy)methyl]-5-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 52734301 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 3-[(3,5-dichlorophenoxy)methyl]-5-ethyl-1,2,4-oxadiazole |
| SMILES | CCc1nc(COc2cc(Cl)cc(Cl)c2)no1 |
| InChI | InChI=1S/C11H10Cl2N2O2/c1-2-11-14-10(15-17-11)6-16-9-4-7(12)3-8(13)5-9/h3-5H,2,6H2,1H3 |
| InChIKey | GZCSTRDPYUEWBL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |