C12H11N3O5 — CID 62115532
3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-4-nitrobenzaldehyde (PubChem CID 62115532) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-4-nitrobenzaldehyde.
| Compound Name | 3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-4-nitrobenzaldehyde |
|---|---|
| PubChem CID | 62115532 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]-4-nitrobenzaldehyde |
| SMILES | CCc1nc(COc2cc(C=O)ccc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C12H11N3O5/c1-2-12-13-11(14-20-12)7-19-10-5-8(6-16)3-4-9(10)15(17)18/h3-6H,2,7H2,1H3 |
| InChIKey | UHIUGSUDXBSGHY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|