C11H8N2O5 — CID 55041204
4-nitro-3-(1,2-oxazol-5-ylmethoxy)benzaldehyde (PubChem CID 55041204) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 4-nitro-3-(1,2-oxazol-5-ylmethoxy)benzaldehyde.
| Compound Name | 4-nitro-3-(1,2-oxazol-5-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 55041204 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-nitro-3-(1,2-oxazol-5-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1ccc([N+](=O)[O-])c(OCc2ccno2)c1 |
| InChI | InChI=1S/C11H8N2O5/c14-6-8-1-2-10(13(15)16)11(5-8)17-7-9-3-4-12-18-9/h1-6H,7H2 |
| InChIKey | ITSYZBINFAFSFQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|