C11H7F3N2O2 — CID 115080597
2-[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]acetaldehyde (PubChem CID 115080597) has the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. Its IUPAC name is 2-[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]acetaldehyde.
| Compound Name | 2-[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115080597 |
| Molecular Formula | C11H7F3N2O2 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1nc(-c2ccccc2C(F)(F)F)no1 |
| InChI | InChI=1S/C11H7F3N2O2/c12-11(13,14)8-4-2-1-3-7(8)10-15-9(5-6-17)18-16-10/h1-4,6H,5H2 |
| InChIKey | KSPZMZOTQCKPTM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|