C11H5ClF3NO2 — CID 131866781
5-chloro-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carbaldehyde (PubChem CID 131866781) has the molecular formula C11H5ClF3NO2 and a molecular weight of 275.61 g/mol. Its IUPAC name is 5-chloro-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carbaldehyde.
| Compound Name | 5-chloro-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 131866781 |
| Molecular Formula | C11H5ClF3NO2 |
| Molecular Weight | 275.61 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 5-chloro-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2C(F)(F)F)noc1Cl |
| InChI | InChI=1S/C11H5ClF3NO2/c12-10-7(5-17)9(16-18-10)6-3-1-2-4-8(6)11(13,14)15/h1-5H |
| InChIKey | XVDNFJCQHHBCOU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|