C22H18N2O6 — CID 168599645
2,2-dimethyl-5-[[3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168599645) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599645 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2,2-dimethyl-5-[[3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2cccc(-c3noc(COc4ccccc4)n3)c2)C(=O)O1 |
| InChI | InChI=1S/C22H18N2O6/c1-22(2)28-20(25)17(21(26)29-22)12-14-7-6-8-15(11-14)19-23-18(30-24-19)13-27-16-9-4-3-5-10-16/h3-12H,13H2,1-2H3 |
| InChIKey | JWHNBLJKBJTRLC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|