C14H10N2O4S — CID 43214779
2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid (PubChem CID 43214779) has the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid.
| Compound Name | 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 43214779 |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1OCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C14H10N2O4S/c17-14(18)10-3-1-2-4-11(10)19-7-12-15-13(16-20-12)9-5-6-21-8-9/h1-6,8H,7H2,(H,17,18) |
| InChIKey | BNDCFXNRWCKADW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |