2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid

C14H10N2O4S — CID 43214779

IUPAC2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCc1nc(-c2ccsc2)no1
InChIInChI=1S/C14H10N2O4S/c17-14(18)10-3-1-2-4-11(10)19-7-12-15-13(16-20-12)9-5-6-21-8-9/h1-6,8H,7H2,(H,17,18)
InChIKeyBNDCFXNRWCKADW-UHFFFAOYSA-N
MW302.31 g/mol
LogP3.08
Rot. Bonds5

About 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid

2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid (PubChem CID 43214779) has the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid.

Molecular Properties

Compound Name2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid
PubChem CID43214779
Molecular FormulaC14H10N2O4S
Molecular Weight302.31 g/mol
Exact Mass302.04
IUPAC Name2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCc1nc(-c2ccsc2)no1
InChIInChI=1S/C14H10N2O4S/c17-14(18)10-3-1-2-4-11(10)19-7-12-15-13(16-20-12)9-5-6-21-8-9/h1-6,8H,7H2,(H,17,18)
InChIKeyBNDCFXNRWCKADW-UHFFFAOYSA-N
XLogP3.08
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.31
LogP ≤ 53.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid?
The IUPAC name of 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid (CID 43214779) is 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid.
What is the SMILES notation for 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid?
The canonical SMILES for 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid is O=C(O)c1ccccc1OCc1nc(-c2ccsc2)no1.
What is the InChIKey of 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid?
The InChIKey is BNDCFXNRWCKADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O4S/c17-14(18)10-3-1-2-4-11(10)19-7-12-15-13(16-20-12)9-5-6-21-8-9/h1-6,8H,7H2,(H,17,18).
What are the key properties of 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid?
2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid has a molecular weight of 302.31 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]benzoic acid is sourced from PubChem (CID 43214779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).