C22H13ClN2O4S — CID 18208845
6-chloro-4-phenyl-7-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]chromen-2-one (PubChem CID 18208845) has the molecular formula C22H13ClN2O4S and a molecular weight of 436.88 g/mol. Its IUPAC name is 6-chloro-4-phenyl-7-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]chromen-2-one.
| Compound Name | 6-chloro-4-phenyl-7-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 18208845 |
| Molecular Formula | C22H13ClN2O4S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 6-chloro-4-phenyl-7-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methoxy]chromen-2-one |
| SMILES | O=c1cc(-c2ccccc2)c2cc(Cl)c(OCc3nc(-c4ccsc4)no3)cc2o1 |
| InChI | InChI=1S/C22H13ClN2O4S/c23-17-8-16-15(13-4-2-1-3-5-13)9-21(26)28-18(16)10-19(17)27-11-20-24-22(25-29-20)14-6-7-30-12-14/h1-10,12H,11H2 |
| InChIKey | WFWZXDNIRXLXLR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|