C16H9ClIN3O2S — CID 24578719
5-[(5-chloro-7-iodoquinolin-8-yl)oxymethyl]-3-thiophen-3-yl-1,2,4-oxadiazole (PubChem CID 24578719) has the molecular formula C16H9ClIN3O2S and a molecular weight of 469.69 g/mol. Its IUPAC name is 5-[(5-chloro-7-iodoquinolin-8-yl)oxymethyl]-3-thiophen-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(5-chloro-7-iodoquinolin-8-yl)oxymethyl]-3-thiophen-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 24578719 |
| Molecular Formula | C16H9ClIN3O2S |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 468.91 |
| IUPAC Name | 5-[(5-chloro-7-iodoquinolin-8-yl)oxymethyl]-3-thiophen-3-yl-1,2,4-oxadiazole |
| SMILES | Clc1cc(I)c(OCc2nc(-c3ccsc3)no2)c2ncccc12 |
| InChI | InChI=1S/C16H9ClIN3O2S/c17-11-6-12(18)15(14-10(11)2-1-4-19-14)22-7-13-20-16(21-23-13)9-3-5-24-8-9/h1-6,8H,7H2 |
| InChIKey | IJKKUOQGUDKHGJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|