C14H11N3O3S — CID 38859277
2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methoxy]benzamide (PubChem CID 38859277) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methoxy]benzamide.
| Compound Name | 2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 38859277 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCc1noc(-c2ccsc2)n1 |
| InChI | InChI=1S/C14H11N3O3S/c15-13(18)10-3-1-2-4-11(10)19-7-12-16-14(20-17-12)9-5-6-21-8-9/h1-6,8H,7H2,(H2,15,18) |
| InChIKey | DXGSQCJDEYWHCY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |