C8H9N3OS — CID 61334504
2-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 61334504) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | 2-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 61334504 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | NCCc1noc(-c2ccsc2)n1 |
| InChI | InChI=1S/C8H9N3OS/c9-3-1-7-10-8(12-11-7)6-2-4-13-5-6/h2,4-5H,1,3,9H2 |
| InChIKey | WMAOIBKTELDBJS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |