C7H7N3OS — CID 47002355
(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methanamine (PubChem CID 47002355) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methanamine.
| Compound Name | (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 47002355 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methanamine |
| SMILES | NCc1noc(-c2ccsc2)n1 |
| InChI | InChI=1S/C7H7N3OS/c8-3-6-9-7(11-10-6)5-1-2-12-4-5/h1-2,4H,3,8H2 |
| InChIKey | MSFWWMBJLSTUIZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |