About 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide
2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide (PubChem CID 71859126) has the molecular formula C15H14N4O2S2
and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide.
Molecular Properties
| Compound Name | 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide |
| PubChem CID | 71859126 |
| Molecular Formula | C15H14N4O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NCc1noc(-c2ccsc2)n1 |
| InChI | InChI=1S/C15H14N4O2S2/c16-13(20)9-23-12-4-2-1-3-11(12)17-7-14-18-15(21-19-14)10-5-6-22-8-10/h1-6,8,17H,7,9H2,(H2,16,20) |
| InChIKey | UWZDHZJUCZCEDY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide?
The IUPAC name of 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide (CID 71859126) is 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide.
What is the SMILES notation for 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide?
The canonical SMILES for 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide is NC(=O)CSc1ccccc1NCc1noc(-c2ccsc2)n1.
What is the InChIKey of 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide?
The InChIKey is UWZDHZJUCZCEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2S2/c16-13(20)9-23-12-4-2-1-3-11(12)17-7-14-18-15(21-19-14)10-5-6-22-8-10/h1-6,8,17H,7,9H2,(H2,16,20).
What are the key properties of 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide?
2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide has a molecular weight of 346.44 g/mol, XLogP of 2.99, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylamino]phenyl]sulfanylacetamide is sourced from PubChem (CID 71859126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).