C13H15N3OS2 — CID 66385351
2-[2-[(3-aminothiophen-2-yl)methylamino]phenyl]sulfanylacetamide (PubChem CID 66385351) has the molecular formula C13H15N3OS2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-[2-[(3-aminothiophen-2-yl)methylamino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[(3-aminothiophen-2-yl)methylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 66385351 |
| Molecular Formula | C13H15N3OS2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[2-[(3-aminothiophen-2-yl)methylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NCc1sccc1N |
| InChI | InChI=1S/C13H15N3OS2/c14-9-5-6-18-12(9)7-16-10-3-1-2-4-11(10)19-8-13(15)17/h1-6,16H,7-8,14H2,(H2,15,17) |
| InChIKey | BCSJNPWIRRNFAP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |