C13H13N3O3S2 — CID 60810588
2-[2-[(5-nitrothiophen-3-yl)methylamino]phenyl]sulfanylacetamide (PubChem CID 60810588) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[2-[(5-nitrothiophen-3-yl)methylamino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[(5-nitrothiophen-3-yl)methylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 60810588 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-[2-[(5-nitrothiophen-3-yl)methylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NCc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N3O3S2/c14-12(17)8-20-11-4-2-1-3-10(11)15-6-9-5-13(16(18)19)21-7-9/h1-5,7,15H,6,8H2,(H2,14,17) |
| InChIKey | KIYVVLIJXNUKPR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|