C10H10N2O3S — CID 43627834
4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid (PubChem CID 43627834) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid.
| Compound Name | 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 43627834 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid |
| SMILES | O=C(O)CCCc1nc(-c2ccsc2)no1 |
| InChI | InChI=1S/C10H10N2O3S/c13-9(14)3-1-2-8-11-10(12-15-8)7-4-5-16-6-7/h4-6H,1-3H2,(H,13,14) |
| InChIKey | SIDKWMTXSFSQJL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |