4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid

C10H10N2O3S — CID 43627834

IUPAC4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid
SMILESO=C(O)CCCc1nc(-c2ccsc2)no1
InChIInChI=1S/C10H10N2O3S/c13-9(14)3-1-2-8-11-10(12-15-8)7-4-5-16-6-7/h4-6H,1-3H2,(H,13,14)
InChIKeySIDKWMTXSFSQJL-UHFFFAOYSA-N
MW238.27 g/mol
LogP2.21
Rot. Bonds5

About 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid

4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid (PubChem CID 43627834) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid.

Molecular Properties

Compound Name4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid
PubChem CID43627834
Molecular FormulaC10H10N2O3S
Molecular Weight238.27 g/mol
Exact Mass238.04
IUPAC Name4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid
SMILESO=C(O)CCCc1nc(-c2ccsc2)no1
InChIInChI=1S/C10H10N2O3S/c13-9(14)3-1-2-8-11-10(12-15-8)7-4-5-16-6-7/h4-6H,1-3H2,(H,13,14)
InChIKeySIDKWMTXSFSQJL-UHFFFAOYSA-N
XLogP2.21
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.27
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid?
The IUPAC name of 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid (CID 43627834) is 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid.
What is the SMILES notation for 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid?
The canonical SMILES for 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid is O=C(O)CCCc1nc(-c2ccsc2)no1.
What is the InChIKey of 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid?
The InChIKey is SIDKWMTXSFSQJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S/c13-9(14)3-1-2-8-11-10(12-15-8)7-4-5-16-6-7/h4-6H,1-3H2,(H,13,14).
What are the key properties of 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid?
4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid has a molecular weight of 238.27 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid is sourced from PubChem (CID 43627834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).