C14H19N3O3S — CID 65289700
4-methyl-6-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylamino]hexanoic acid (PubChem CID 65289700) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-methyl-6-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylamino]hexanoic acid.
| Compound Name | 4-methyl-6-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 65289700 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-methyl-6-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methylamino]hexanoic acid |
| SMILES | CC(CCNCc1nc(-c2ccsc2)no1)CCC(=O)O |
| InChI | InChI=1S/C14H19N3O3S/c1-10(2-3-13(18)19)4-6-15-8-12-16-14(17-20-12)11-5-7-21-9-11/h5,7,9-10,15H,2-4,6,8H2,1H3,(H,18,19) |
| InChIKey | NKZKTVUQZUWZCX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|