C13H14N2O4 — CID 55539427
(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-hydroxybenzoate (PubChem CID 55539427) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-hydroxybenzoate.
| Compound Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-hydroxybenzoate |
|---|---|
| PubChem CID | 55539427 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 3-hydroxybenzoate |
| SMILES | CC(C)c1noc(COC(=O)c2cccc(O)c2)n1 |
| InChI | InChI=1S/C13H14N2O4/c1-8(2)12-14-11(19-15-12)7-18-13(17)9-4-3-5-10(16)6-9/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | LEELHKBSZLTMCS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |