C8H14N2O3 — CID 66264295
(1S)-1-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 66264295) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is (1S)-1-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | (1S)-1-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 66264295 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (1S)-1-[3-(3-methoxypropyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | COCCCc1noc([C@H](C)O)n1 |
| InChI | InChI=1S/C8H14N2O3/c1-6(11)8-9-7(10-13-8)4-3-5-12-2/h6,11H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | JJZVQCYJSBYTEK-LURJTMIESA-N |
| XLogP | 0.70 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|