C7H12N2O3 — CID 63349188
1-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 63349188) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | 1-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 63349188 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | COCCc1noc(C(C)O)n1 |
| InChI | InChI=1S/C7H12N2O3/c1-5(10)7-8-6(9-12-7)3-4-11-2/h5,10H,3-4H2,1-2H3 |
| InChIKey | GRVJVKVCNKSZLW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |