C12H20N2O5 — CID 102926997
ethyl 2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 102926997) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl 2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | ethyl 2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 102926997 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl 2-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | CCOC(=O)C(C)c1nc(CCOCCOC)no1 |
| InChI | InChI=1S/C12H20N2O5/c1-4-18-12(15)9(2)11-13-10(14-19-11)5-6-17-8-7-16-3/h9H,4-8H2,1-3H3 |
| InChIKey | ZBRZCNZSRLKPGY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|