C9H17N3O3 — CID 102926963
(1S)-1-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 102926963) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is (1S)-1-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | (1S)-1-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 102926963 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (1S)-1-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | COCCOCCc1noc([C@H](C)N)n1 |
| InChI | InChI=1S/C9H17N3O3/c1-7(10)9-11-8(12-15-9)3-4-14-6-5-13-2/h7H,3-6,10H2,1-2H3/t7-/m0/s1 |
| InChIKey | SEDVCUFXFZHARS-ZETCQYMHSA-N |
| XLogP | 0.29 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|