C13H15ClN2O2 — CID 63345077
4-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]butan-2-ol (PubChem CID 63345077) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 4-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]butan-2-ol.
| Compound Name | 4-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]butan-2-ol |
|---|---|
| PubChem CID | 63345077 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-[3-[(4-chlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]butan-2-ol |
| SMILES | CC(O)CCc1nc(Cc2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C13H15ClN2O2/c1-9(17)2-7-13-15-12(16-18-13)8-10-3-5-11(14)6-4-10/h3-6,9,17H,2,7-8H2,1H3 |
| InChIKey | QDEUGBVBEOMBGZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |