C10H16N2O2 — CID 102660427
[5-(2-cyclopentylethyl)-1,2,4-oxadiazol-3-yl]methanol (PubChem CID 102660427) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is [5-(2-cyclopentylethyl)-1,2,4-oxadiazol-3-yl]methanol.
| Compound Name | [5-(2-cyclopentylethyl)-1,2,4-oxadiazol-3-yl]methanol |
|---|---|
| PubChem CID | 102660427 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | [5-(2-cyclopentylethyl)-1,2,4-oxadiazol-3-yl]methanol |
| SMILES | OCc1noc(CCC2CCCC2)n1 |
| InChI | InChI=1S/C10H16N2O2/c13-7-9-11-10(14-12-9)6-5-8-3-1-2-4-8/h8,13H,1-7H2 |
| InChIKey | HBSXPWQNRLKRHI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |