About [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine
[5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine (PubChem CID 61326432) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine.
Analyze [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine?
The IUPAC name of [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine (CID 61326432) is [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine.
What is the SMILES notation for [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine?
The canonical SMILES for [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine is NCc1noc(CC2CCCCC2)n1.
What is the InChIKey of [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine?
The InChIKey is ZFLPOFVNVKYXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c11-7-9-12-10(14-13-9)6-8-4-2-1-3-5-8/h8H,1-7,11H2.
What are the key properties of [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine?
[5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine has a molecular weight of 195.27 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(cyclohexylmethyl)-1,2,4-oxadiazol-3-yl]methanamine is sourced from PubChem (CID 61326432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).