C13H22N2O — CID 105479693
4-tert-butyl-5-methyl-2-piperidin-4-yl-1,3-oxazole (PubChem CID 105479693) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-tert-butyl-5-methyl-2-piperidin-4-yl-1,3-oxazole.
| Compound Name | 4-tert-butyl-5-methyl-2-piperidin-4-yl-1,3-oxazole |
|---|---|
| PubChem CID | 105479693 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-tert-butyl-5-methyl-2-piperidin-4-yl-1,3-oxazole |
| SMILES | Cc1oc(C2CCNCC2)nc1C(C)(C)C |
| InChI | InChI=1S/C13H22N2O/c1-9-11(13(2,3)4)15-12(16-9)10-5-7-14-8-6-10/h10,14H,5-8H2,1-4H3 |
| InChIKey | ABXYXRNSNPYUGV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |