C10H16N4 — CID 82468969
2,4-dimethyl-6-piperidin-4-yl-1,3,5-triazine (PubChem CID 82468969) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 2,4-dimethyl-6-piperidin-4-yl-1,3,5-triazine.
| Compound Name | 2,4-dimethyl-6-piperidin-4-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 82468969 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2,4-dimethyl-6-piperidin-4-yl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(C2CCNCC2)n1 |
| InChI | InChI=1S/C10H16N4/c1-7-12-8(2)14-10(13-7)9-3-5-11-6-4-9/h9,11H,3-6H2,1-2H3 |
| InChIKey | JCAGVODJDRSLSV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |