acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate

C14H19N3O3 — CID 144611087

IUPACacetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate
SMILESCC(=O)OC(=O)c1c(C)nc(C)nc1C1CCNCC1
InChIInChI=1S/C14H19N3O3/c1-8-12(14(19)20-10(3)18)13(17-9(2)16-8)11-4-6-15-7-5-11/h11,15H,4-7H2,1-3H3
InChIKeyWMWUKINXHAOXNH-UHFFFAOYSA-N
MW277.32 g/mol
LogP1.26
Rot. Bonds2

About acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate

acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate (PubChem CID 144611087) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate.

Molecular Properties

Compound Nameacetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate
PubChem CID144611087
Molecular FormulaC14H19N3O3
Molecular Weight277.32 g/mol
Exact Mass277.14
IUPAC Nameacetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate
SMILESCC(=O)OC(=O)c1c(C)nc(C)nc1C1CCNCC1
InChIInChI=1S/C14H19N3O3/c1-8-12(14(19)20-10(3)18)13(17-9(2)16-8)11-4-6-15-7-5-11/h11,15H,4-7H2,1-3H3
InChIKeyWMWUKINXHAOXNH-UHFFFAOYSA-N
XLogP1.26
TPSA81.18 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.32
LogP ≤ 51.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate?
The IUPAC name of acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate (CID 144611087) is acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate.
What is the SMILES notation for acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate?
The canonical SMILES for acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate is CC(=O)OC(=O)c1c(C)nc(C)nc1C1CCNCC1.
What is the InChIKey of acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate?
The InChIKey is WMWUKINXHAOXNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O3/c1-8-12(14(19)20-10(3)18)13(17-9(2)16-8)11-4-6-15-7-5-11/h11,15H,4-7H2,1-3H3.
What are the key properties of acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate?
acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate has a molecular weight of 277.32 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 2,4-dimethyl-6-piperidin-4-ylpyrimidine-5-carboxylate is sourced from PubChem (CID 144611087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).