C9H16N4O — CID 82463437
4-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine (PubChem CID 82463437) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine.
| Compound Name | 4-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine |
|---|---|
| PubChem CID | 82463437 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine |
| SMILES | COCc1nc(C2CCNCC2)n[nH]1 |
| InChI | InChI=1S/C9H16N4O/c1-14-6-8-11-9(13-12-8)7-2-4-10-5-3-7/h7,10H,2-6H2,1H3,(H,11,12,13) |
| InChIKey | LBIYSJVIZIXJMS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |