C16H22N4O2 — CID 131927834
4-[5-[(4-ethoxyphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine (PubChem CID 131927834) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[5-[(4-ethoxyphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine.
| Compound Name | 4-[5-[(4-ethoxyphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine |
|---|---|
| PubChem CID | 131927834 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-[5-[(4-ethoxyphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine |
| SMILES | CCOc1ccc(OCc2nc(C3CCNCC3)n[nH]2)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-2-21-13-3-5-14(6-4-13)22-11-15-18-16(20-19-15)12-7-9-17-10-8-12/h3-6,12,17H,2,7-11H2,1H3,(H,18,19,20) |
| InChIKey | VPUYGFDADYRANY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |