C18H26N4O — CID 131946073
(2S)-2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine (PubChem CID 131946073) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S)-2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine.
| Compound Name | (2S)-2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine |
|---|---|
| PubChem CID | 131946073 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2S)-2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]piperidine |
| SMILES | CC(C)(C)c1ccc(OCc2nc([C@@H]3CCCCN3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H26N4O/c1-18(2,3)13-7-9-14(10-8-13)23-12-16-20-17(22-21-16)15-6-4-5-11-19-15/h7-10,15,19H,4-6,11-12H2,1-3H3,(H,20,21,22)/t15-/m0/s1 |
| InChIKey | LHBOIGWDVUVOKI-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |