C13H13F3N4 — CID 82568314
3-pyrrolidin-2-yl-5-[(2,3,4-trifluorophenyl)methyl]-1H-1,2,4-triazole (PubChem CID 82568314) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 3-pyrrolidin-2-yl-5-[(2,3,4-trifluorophenyl)methyl]-1H-1,2,4-triazole.
| Compound Name | 3-pyrrolidin-2-yl-5-[(2,3,4-trifluorophenyl)methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 82568314 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-pyrrolidin-2-yl-5-[(2,3,4-trifluorophenyl)methyl]-1H-1,2,4-triazole |
| SMILES | Fc1ccc(Cc2nc(C3CCCN3)n[nH]2)c(F)c1F |
| InChI | InChI=1S/C13H13F3N4/c14-8-4-3-7(11(15)12(8)16)6-10-18-13(20-19-10)9-2-1-5-17-9/h3-4,9,17H,1-2,5-6H2,(H,18,19,20) |
| InChIKey | YTCMDGHTPYBWKY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|