C13H13F2N3O — CID 60916016
5-(2,6-difluorophenyl)-3-piperidin-2-yl-1,2,4-oxadiazole (PubChem CID 60916016) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-3-piperidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2,6-difluorophenyl)-3-piperidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 60916016 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 5-(2,6-difluorophenyl)-3-piperidin-2-yl-1,2,4-oxadiazole |
| SMILES | Fc1cccc(F)c1-c1nc(C2CCCCN2)no1 |
| InChI | InChI=1S/C13H13F2N3O/c14-8-4-3-5-9(15)11(8)13-17-12(18-19-13)10-6-1-2-7-16-10/h3-5,10,16H,1-2,6-7H2 |
| InChIKey | JOAXYCILRFFEQT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |