C10H13N5O — CID 129368246
3-[(2R)-piperidin-2-yl]-5-(1H-pyrazol-5-yl)-1,2,4-oxadiazole (PubChem CID 129368246) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 3-[(2R)-piperidin-2-yl]-5-(1H-pyrazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[(2R)-piperidin-2-yl]-5-(1H-pyrazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 129368246 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-[(2R)-piperidin-2-yl]-5-(1H-pyrazol-5-yl)-1,2,4-oxadiazole |
| SMILES | c1cc(-c2nc([C@H]3CCCCN3)no2)[nH]n1 |
| InChI | InChI=1S/C10H13N5O/c1-2-5-11-7(3-1)9-13-10(16-15-9)8-4-6-12-14-8/h4,6-7,11H,1-3,5H2,(H,12,14)/t7-/m1/s1 |
| InChIKey | JKHMQNYZLIJBMG-SSDOTTSWSA-N |
| XLogP | 1.27 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |