C16H21N3O — CID 103972133
3-(azepan-2-yl)-5-(3,5-dimethylphenyl)-1,2,4-oxadiazole (PubChem CID 103972133) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-(azepan-2-yl)-5-(3,5-dimethylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(azepan-2-yl)-5-(3,5-dimethylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103972133 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 3-(azepan-2-yl)-5-(3,5-dimethylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(C)cc(-c2nc(C3CCCCCN3)no2)c1 |
| InChI | InChI=1S/C16H21N3O/c1-11-8-12(2)10-13(9-11)16-18-15(19-20-16)14-6-4-3-5-7-17-14/h8-10,14,17H,3-7H2,1-2H3 |
| InChIKey | DXVHWUOHXGPSOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |