C13H16N4O — CID 106753992
5-(2-methyl-4-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole (PubChem CID 106753992) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-(2-methyl-4-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2-methyl-4-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106753992 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-(2-methyl-4-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2nc(C3CCCCN3)no2)ccn1 |
| InChI | InChI=1S/C13H16N4O/c1-9-8-10(5-7-14-9)13-16-12(17-18-13)11-4-2-3-6-15-11/h5,7-8,11,15H,2-4,6H2,1H3 |
| InChIKey | GJXBDEUBXQDMOA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |