C13H16N4O2 — CID 55023638
5-(2-methoxy-3-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole (PubChem CID 55023638) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(2-methoxy-3-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2-methoxy-3-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55023638 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-(2-methoxy-3-pyridinyl)-3-piperidin-2-yl-1,2,4-oxadiazole |
| SMILES | COc1ncccc1-c1nc(C2CCCCN2)no1 |
| InChI | InChI=1S/C13H16N4O2/c1-18-12-9(5-4-8-15-12)13-16-11(17-19-13)10-6-2-3-7-14-10/h4-5,8,10,14H,2-3,6-7H2,1H3 |
| InChIKey | VSAVSKSNCZPNDG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |