About 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride
2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride (PubChem CID 119032101) has the molecular formula C9H17ClN4O
and a molecular weight of 232.71 g/mol. Its IUPAC name is 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride |
| PubChem CID | 119032101 |
| Molecular Formula | C9H17ClN4O |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride |
| SMILES | COCc1nc(C2CCCCN2)n[nH]1.Cl |
| InChI | InChI=1S/C9H16N4O.ClH/c1-14-6-8-11-9(13-12-8)7-4-2-3-5-10-7;/h7,10H,2-6H2,1H3,(H,11,12,13);1H |
| InChIKey | FOJHKFKNVLZMNZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride?
The IUPAC name of 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride (CID 119032101) is 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride.
What is the SMILES notation for 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride?
The canonical SMILES for 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride is COCc1nc(C2CCCCN2)n[nH]1.Cl.
What is the InChIKey of 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride?
The InChIKey is FOJHKFKNVLZMNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O.ClH/c1-14-6-8-11-9(13-12-8)7-4-2-3-5-10-7;/h7,10H,2-6H2,1H3,(H,11,12,13);1H.
What are the key properties of 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride?
2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride has a molecular weight of 232.71 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]piperidine;hydrochloride is sourced from PubChem (CID 119032101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).