About 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride
2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride (PubChem CID 91662957) has the molecular formula C8H16Cl2N4
and a molecular weight of 239.15 g/mol. Its IUPAC name is 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride |
| PubChem CID | 91662957 |
| Molecular Formula | C8H16Cl2N4 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride |
| SMILES | Cc1nc(C2CCCCN2)n[nH]1.Cl.Cl |
| InChI | InChI=1S/C8H14N4.2ClH/c1-6-10-8(12-11-6)7-4-2-3-5-9-7;;/h7,9H,2-5H2,1H3,(H,10,11,12);2*1H |
| InChIKey | KLGXRCIKIFRJMZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
The IUPAC name of 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride (CID 91662957) is 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride.
What is the SMILES notation for 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
The canonical SMILES for 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride is Cc1nc(C2CCCCN2)n[nH]1.Cl.Cl.
What is the InChIKey of 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
The InChIKey is KLGXRCIKIFRJMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4.2ClH/c1-6-10-8(12-11-6)7-4-2-3-5-9-7;;/h7,9H,2-5H2,1H3,(H,10,11,12);2*1H.
What are the key properties of 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride has a molecular weight of 239.15 g/mol, XLogP of 1.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride is sourced from PubChem (CID 91662957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).