C11H12BrF2N — CID 84714328
2-(2-bromo-3,4-difluorophenyl)piperidine (PubChem CID 84714328) has the molecular formula C11H12BrF2N and a molecular weight of 276.12 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)piperidine.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)piperidine |
|---|---|
| PubChem CID | 84714328 |
| Molecular Formula | C11H12BrF2N |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)piperidine |
| SMILES | Fc1ccc(C2CCCCN2)c(Br)c1F |
| InChI | InChI=1S/C11H12BrF2N/c12-10-7(4-5-8(13)11(10)14)9-3-1-2-6-15-9/h4-5,9,15H,1-3,6H2 |
| InChIKey | IDFLDNCFQAPLEH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|