C11H12ClF2N — CID 84795035
2-(5-chloro-2,3-difluorophenyl)piperidine (PubChem CID 84795035) has the molecular formula C11H12ClF2N and a molecular weight of 231.67 g/mol. Its IUPAC name is 2-(5-chloro-2,3-difluorophenyl)piperidine.
| Compound Name | 2-(5-chloro-2,3-difluorophenyl)piperidine |
|---|---|
| PubChem CID | 84795035 |
| Molecular Formula | C11H12ClF2N |
| Molecular Weight | 231.67 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-(5-chloro-2,3-difluorophenyl)piperidine |
| SMILES | Fc1cc(Cl)cc(C2CCCCN2)c1F |
| InChI | InChI=1S/C11H12ClF2N/c12-7-5-8(11(14)9(13)6-7)10-3-1-2-4-15-10/h5-6,10,15H,1-4H2 |
| InChIKey | LGAIPLYIYLVWMZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.67 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|