C10H11ClF3N — CID 171196335
(2S)-2-(2,3,5-trifluorophenyl)pyrrolidine;hydrochloride (PubChem CID 171196335) has the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. Its IUPAC name is (2S)-2-(2,3,5-trifluorophenyl)pyrrolidine;hydrochloride.
| Compound Name | (2S)-2-(2,3,5-trifluorophenyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 171196335 |
| Molecular Formula | C10H11ClF3N |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | (2S)-2-(2,3,5-trifluorophenyl)pyrrolidine;hydrochloride |
| SMILES | Cl.Fc1cc(F)c(F)c([C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C10H10F3N.ClH/c11-6-4-7(9-2-1-3-14-9)10(13)8(12)5-6;/h4-5,9,14H,1-3H2;1H/t9-;/m0./s1 |
| InChIKey | NYJHPMNXXUEVNP-FVGYRXGTSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|