About (3R)-3-(2,3,5-trifluorophenyl)morpholine
(3R)-3-(2,3,5-trifluorophenyl)morpholine (PubChem CID 131262758) has the molecular formula C10H10F3NO
and a molecular weight of 217.19 g/mol. Its IUPAC name is (3R)-3-(2,3,5-trifluorophenyl)morpholine.
Molecular Properties
| Compound Name | (3R)-3-(2,3,5-trifluorophenyl)morpholine |
| PubChem CID | 131262758 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (3R)-3-(2,3,5-trifluorophenyl)morpholine |
| SMILES | Fc1cc(F)c(F)c([C@@H]2COCCN2)c1 |
| InChI | InChI=1S/C10H10F3NO/c11-6-3-7(10(13)8(12)4-6)9-5-15-2-1-14-9/h3-4,9,14H,1-2,5H2/t9-/m0/s1 |
| InChIKey | GHZLNXMQKAXXAS-VIFPVBQESA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(2,3,5-trifluorophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(2,3,5-trifluorophenyl)morpholine?
The IUPAC name of (3R)-3-(2,3,5-trifluorophenyl)morpholine (CID 131262758) is (3R)-3-(2,3,5-trifluorophenyl)morpholine.
What is the SMILES notation for (3R)-3-(2,3,5-trifluorophenyl)morpholine?
The canonical SMILES for (3R)-3-(2,3,5-trifluorophenyl)morpholine is Fc1cc(F)c(F)c([C@@H]2COCCN2)c1.
What is the InChIKey of (3R)-3-(2,3,5-trifluorophenyl)morpholine?
The InChIKey is GHZLNXMQKAXXAS-VIFPVBQESA-N. The full InChI is InChI=1S/C10H10F3NO/c11-6-3-7(10(13)8(12)4-6)9-5-15-2-1-14-9/h3-4,9,14H,1-2,5H2/t9-/m0/s1.
What are the key properties of (3R)-3-(2,3,5-trifluorophenyl)morpholine?
(3R)-3-(2,3,5-trifluorophenyl)morpholine has a molecular weight of 217.19 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(2,3,5-trifluorophenyl)morpholine is sourced from PubChem (CID 131262758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).