C10H11ClF3NO — CID 171193179
(3S)-3-(3,4,5-trifluorophenyl)morpholine;hydrochloride (PubChem CID 171193179) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is (3S)-3-(3,4,5-trifluorophenyl)morpholine;hydrochloride.
| Compound Name | (3S)-3-(3,4,5-trifluorophenyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 171193179 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (3S)-3-(3,4,5-trifluorophenyl)morpholine;hydrochloride |
| SMILES | Cl.Fc1cc([C@H]2COCCN2)cc(F)c1F |
| InChI | InChI=1S/C10H10F3NO.ClH/c11-7-3-6(4-8(12)10(7)13)9-5-15-2-1-14-9;/h3-4,9,14H,1-2,5H2;1H/t9-;/m1./s1 |
| InChIKey | UQIUJMDXHUFQRA-SBSPUUFOSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|