C10H12ClF2NO — CID 171192618
(3R)-3-(3,5-difluorophenyl)morpholine;hydrochloride (PubChem CID 171192618) has the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. Its IUPAC name is (3R)-3-(3,5-difluorophenyl)morpholine;hydrochloride.
| Compound Name | (3R)-3-(3,5-difluorophenyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 171192618 |
| Molecular Formula | C10H12ClF2NO |
| Molecular Weight | 235.66 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | (3R)-3-(3,5-difluorophenyl)morpholine;hydrochloride |
| SMILES | Cl.Fc1cc(F)cc([C@@H]2COCCN2)c1 |
| InChI | InChI=1S/C10H11F2NO.ClH/c11-8-3-7(4-9(12)5-8)10-6-14-2-1-13-10;/h3-5,10,13H,1-2,6H2;1H/t10-;/m0./s1 |
| InChIKey | LLAYYPHHQYXVEZ-PPHPATTJSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.66 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |