C10H11F2NO — CID 55271784
3-(3,5-difluorophenyl)morpholine (PubChem CID 55271784) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)morpholine.
| Compound Name | 3-(3,5-difluorophenyl)morpholine |
|---|---|
| PubChem CID | 55271784 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-(3,5-difluorophenyl)morpholine |
| SMILES | Fc1cc(F)cc(C2COCCN2)c1 |
| InChI | InChI=1S/C10H11F2NO/c11-8-3-7(4-9(12)5-8)10-6-14-2-1-13-10/h3-5,10,13H,1-2,6H2 |
| InChIKey | MRVDVOWEXQWUBH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |