C10H11F2NO2 — CID 84783766
4,5-difluoro-2-morpholin-3-ylphenol (PubChem CID 84783766) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 4,5-difluoro-2-morpholin-3-ylphenol.
| Compound Name | 4,5-difluoro-2-morpholin-3-ylphenol |
|---|---|
| PubChem CID | 84783766 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4,5-difluoro-2-morpholin-3-ylphenol |
| SMILES | Oc1cc(F)c(F)cc1C1COCCN1 |
| InChI | InChI=1S/C10H11F2NO2/c11-7-3-6(10(14)4-8(7)12)9-5-15-2-1-13-9/h3-4,9,13-14H,1-2,5H2 |
| InChIKey | KPGALDJDMABMDD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|