C11H15NO3 — CID 84780563
4-methyl-6-morpholin-3-ylbenzene-1,3-diol (PubChem CID 84780563) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-methyl-6-morpholin-3-ylbenzene-1,3-diol.
| Compound Name | 4-methyl-6-morpholin-3-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 84780563 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-methyl-6-morpholin-3-ylbenzene-1,3-diol |
| SMILES | Cc1cc(C2COCCN2)c(O)cc1O |
| InChI | InChI=1S/C11H15NO3/c1-7-4-8(11(14)5-10(7)13)9-6-15-3-2-12-9/h4-5,9,12-14H,2-3,6H2,1H3 |
| InChIKey | WLCOTORTNQKLJO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|