C12H16ClNO — CID 84790642
3-(4-chloro-2,5-dimethylphenyl)morpholine (PubChem CID 84790642) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethylphenyl)morpholine.
| Compound Name | 3-(4-chloro-2,5-dimethylphenyl)morpholine |
|---|---|
| PubChem CID | 84790642 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-(4-chloro-2,5-dimethylphenyl)morpholine |
| SMILES | Cc1cc(C2COCCN2)c(C)cc1Cl |
| InChI | InChI=1S/C12H16ClNO/c1-8-6-11(13)9(2)5-10(8)12-7-15-4-3-14-12/h5-6,12,14H,3-4,7H2,1-2H3 |
| InChIKey | DIFSWOFGSAYZKV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |